C22H24N4OS — CID 42857505
N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]thiophene-2-carboxamide (PubChem CID 42857505) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]thiophene-2-carboxamide.
| Compound Name | N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42857505 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3ccccc3)CC2)nc1)c1cccs1 |
| InChI | InChI=1S/C22H24N4OS/c27-22(20-8-4-15-28-20)24-19-9-10-21(23-16-19)26-12-5-11-25(13-14-26)17-18-6-2-1-3-7-18/h1-4,6-10,15-16H,5,11-14,17H2,(H,24,27) |
| InChIKey | RKDYMAGLJQIPNR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |