C22H24N4OS — CID 46042185
N-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 46042185) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 46042185 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(N2CCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C22H24N4OS/c27-22(15-20-7-4-14-28-20)24-19-8-9-21(23-16-19)26-12-10-25(11-13-26)17-18-5-2-1-3-6-18/h1-9,14,16H,10-13,15,17H2,(H,24,27) |
| InChIKey | MWBNNDBRLKWVIZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |