C26H31N5O2 — CID 42857480
N-[6-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-3-pyridinyl]-2-phenoxyacetamide (PubChem CID 42857480) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[6-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-3-pyridinyl]-2-phenoxyacetamide.
| Compound Name | N-[6-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-3-pyridinyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 42857480 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[6-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-3-pyridinyl]-2-phenoxyacetamide |
| SMILES | CN(C)c1ccc(CN2CCN(c3ccc(NC(=O)COc4ccccc4)cn3)CC2)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-29(2)23-11-8-21(9-12-23)19-30-14-16-31(17-15-30)25-13-10-22(18-27-25)28-26(32)20-33-24-6-4-3-5-7-24/h3-13,18H,14-17,19-20H2,1-2H3,(H,28,32) |
| InChIKey | CXPOLNVKEHKIKQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|