C25H27N5O3 — CID 83285222
1-[6-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-phenylurea (PubChem CID 83285222) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[6-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-phenylurea.
| Compound Name | 1-[6-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 83285222 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[6-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-phenylurea |
| SMILES | COc1ccc(C(=O)N2CCCN(c3ccc(NC(=O)Nc4ccccc4)cn3)CC2)cc1 |
| InChI | InChI=1S/C25H27N5O3/c1-33-22-11-8-19(9-12-22)24(31)30-15-5-14-29(16-17-30)23-13-10-21(18-26-23)28-25(32)27-20-6-3-2-4-7-20/h2-4,6-13,18H,5,14-17H2,1H3,(H2,27,28,32) |
| InChIKey | WYXXOIDBHVFECX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |