C24H23ClFN5O2 — CID 46053467
1-(2-chlorophenyl)-3-[6-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]urea (PubChem CID 46053467) has the molecular formula C24H23ClFN5O2 and a molecular weight of 467.93 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[6-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[6-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 46053467 |
| Molecular Formula | C24H23ClFN5O2 |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[6-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(N2CCCN(C(=O)c3cccc(F)c3)CC2)nc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H23ClFN5O2/c25-20-7-1-2-8-21(20)29-24(33)28-19-9-10-22(27-16-19)30-11-4-12-31(14-13-30)23(32)17-5-3-6-18(26)15-17/h1-3,5-10,15-16H,4,11-14H2,(H2,28,29,33) |
| InChIKey | KXACNILCSXCHOE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |