C23H20ClF2N5O2 — CID 42850132
1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,4-difluorophenyl)urea (PubChem CID 42850132) has the molecular formula C23H20ClF2N5O2 and a molecular weight of 471.90 g/mol. Its IUPAC name is 1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 42850132 |
| Molecular Formula | C23H20ClF2N5O2 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3Cl)CC2)nc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H20ClF2N5O2/c24-18-4-2-1-3-17(18)22(32)31-11-9-30(10-12-31)21-8-6-16(14-27-21)28-23(33)29-20-7-5-15(25)13-19(20)26/h1-8,13-14H,9-12H2,(H2,28,29,33) |
| InChIKey | VSVSYGCLYKSYAN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |