C24H21ClF3N5O2 — CID 46042109
1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 46042109) has the molecular formula C24H21ClF3N5O2 and a molecular weight of 503.91 g/mol. Its IUPAC name is 1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 46042109 |
| Molecular Formula | C24H21ClF3N5O2 |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 1-[6-[4-(2-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccc(N2CCN(C(=O)c3ccccc3Cl)CC2)nc1 |
| InChI | InChI=1S/C24H21ClF3N5O2/c25-20-4-2-1-3-19(20)22(34)33-13-11-32(12-14-33)21-10-9-18(15-29-21)31-23(35)30-17-7-5-16(6-8-17)24(26,27)28/h1-10,15H,11-14H2,(H2,30,31,35) |
| InChIKey | CKWMVHFIIWVUQD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |