C24H22Cl2N4O2 — CID 42850069
N-[6-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-2-methylbenzamide (PubChem CID 42850069) has the molecular formula C24H22Cl2N4O2 and a molecular weight of 469.37 g/mol. Its IUPAC name is N-[6-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-2-methylbenzamide.
| Compound Name | N-[6-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 42850069 |
| Molecular Formula | C24H22Cl2N4O2 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[6-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)nc1 |
| InChI | InChI=1S/C24H22Cl2N4O2/c1-16-4-2-3-5-19(16)23(31)28-18-7-9-22(27-15-18)29-10-12-30(13-11-29)24(32)20-8-6-17(25)14-21(20)26/h2-9,14-15H,10-13H2,1H3,(H,28,31) |
| InChIKey | UTCRWGOYCVIKOC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |