C17H16ClF3N4O — CID 55351597
N-(2-chlorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (PubChem CID 55351597) has the molecular formula C17H16ClF3N4O and a molecular weight of 384.79 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55351597 |
| Molecular Formula | C17H16ClF3N4O |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-(2-chlorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H16ClF3N4O/c18-13-3-1-2-4-14(13)23-16(26)25-9-7-24(8-10-25)15-6-5-12(11-22-15)17(19,20)21/h1-6,11H,7-10H2,(H,23,26) |
| InChIKey | OSKQCMNPMQJEJD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |