C16H14ClF3N4O — CID 10044700
1-(2-chlorophenyl)-3-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]urea (PubChem CID 10044700) has the molecular formula C16H14ClF3N4O and a molecular weight of 370.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]urea |
|---|---|
| PubChem CID | 10044700 |
| Molecular Formula | C16H14ClF3N4O |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]urea |
| SMILES | O=C(Nc1ccccc1Cl)NC1CN(c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C16H14ClF3N4O/c17-12-3-1-2-4-13(12)23-15(25)22-11-8-24(9-11)14-6-5-10(7-21-14)16(18,19)20/h1-7,11H,8-9H2,(H2,22,23,25) |
| InChIKey | DPNWTPUYXVOKCF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |