C15H21F3N4O — CID 95714073
1-propan-2-yl-3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]urea (PubChem CID 95714073) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-propan-2-yl-3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]urea.
| Compound Name | 1-propan-2-yl-3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]urea |
|---|---|
| PubChem CID | 95714073 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-propan-2-yl-3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]urea |
| SMILES | CC(C)NC(=O)N[C@@H]1CCCN(c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C15H21F3N4O/c1-10(2)20-14(23)21-12-4-3-7-22(9-12)13-6-5-11(8-19-13)15(16,17)18/h5-6,8,10,12H,3-4,7,9H2,1-2H3,(H2,20,21,23)/t12-/m1/s1 |
| InChIKey | QJNLFWRYKVIISJ-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |