C19H26F3N3O — CID 121142589
3-cyclohexyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide (PubChem CID 121142589) has the molecular formula C19H26F3N3O and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 121142589 |
| Molecular Formula | C19H26F3N3O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 3-cyclohexyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NC1CCN(c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C19H26F3N3O/c20-19(21,22)15-7-8-17(23-12-15)25-11-10-16(13-25)24-18(26)9-6-14-4-2-1-3-5-14/h7-8,12,14,16H,1-6,9-11,13H2,(H,24,26) |
| InChIKey | ZCWOCMQZHLNLCU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |