C20H22F3N3O — CID 121142708
3-(3-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide (PubChem CID 121142708) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-(3-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide.
| Compound Name | 3-(3-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 121142708 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-(3-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]propanamide |
| SMILES | Cc1cccc(CCC(=O)NC2CCN(c3ccc(C(F)(F)F)cn3)C2)c1 |
| InChI | InChI=1S/C20H22F3N3O/c1-14-3-2-4-15(11-14)5-8-19(27)25-17-9-10-26(13-17)18-7-6-16(12-24-18)20(21,22)23/h2-4,6-7,11-12,17H,5,8-10,13H2,1H3,(H,25,27) |
| InChIKey | AACRWLPNKGWNDP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |