C18H19F3N4O — CID 55740451
1-(6-pyrrolidin-1-yl-3-pyridinyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 55740451) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-(6-pyrrolidin-1-yl-3-pyridinyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(6-pyrrolidin-1-yl-3-pyridinyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55740451 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-(6-pyrrolidin-1-yl-3-pyridinyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C18H19F3N4O/c19-18(20,21)14-5-3-13(4-6-14)11-23-17(26)24-15-7-8-16(22-12-15)25-9-1-2-10-25/h3-8,12H,1-2,9-11H2,(H2,23,24,26) |
| InChIKey | XWJOKLZXTSYEHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |