C17H21N5O3 — CID 51078466
1-(6-methoxy-3-pyridinyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea (PubChem CID 51078466) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 51078466 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea |
| SMILES | COc1ccc(NC(=O)NCc2ccc(N3CCOCC3)nc2)cn1 |
| InChI | InChI=1S/C17H21N5O3/c1-24-16-5-3-14(12-19-16)21-17(23)20-11-13-2-4-15(18-10-13)22-6-8-25-9-7-22/h2-5,10,12H,6-9,11H2,1H3,(H2,20,21,23) |
| InChIKey | ZKLNNEGXZZKBDR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |