C15H24N4O3 — CID 95156925
1-[(2S)-2-hydroxy-2-methylbutyl]-3-(6-morpholin-4-yl-3-pyridinyl)urea (PubChem CID 95156925) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-2-methylbutyl]-3-(6-morpholin-4-yl-3-pyridinyl)urea.
| Compound Name | 1-[(2S)-2-hydroxy-2-methylbutyl]-3-(6-morpholin-4-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 95156925 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[(2S)-2-hydroxy-2-methylbutyl]-3-(6-morpholin-4-yl-3-pyridinyl)urea |
| SMILES | CC[C@](C)(O)CNC(=O)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C15H24N4O3/c1-3-15(2,21)11-17-14(20)18-12-4-5-13(16-10-12)19-6-8-22-9-7-19/h4-5,10,21H,3,6-9,11H2,1-2H3,(H2,17,18,20)/t15-/m0/s1 |
| InChIKey | JXZMLYLWBOMNOI-HNNXBMFYSA-N |
| XLogP | 1.20 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |