C13H22Cl2N4O2 — CID 119839706
(2S)-2-amino-N-(6-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride (PubChem CID 119839706) has the molecular formula C13H22Cl2N4O2 and a molecular weight of 337.25 g/mol. Its IUPAC name is (2S)-2-amino-N-(6-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-(6-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119839706 |
| Molecular Formula | C13H22Cl2N4O2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S)-2-amino-N-(6-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride |
| SMILES | CC[C@H](N)C(=O)Nc1ccc(N2CCOCC2)nc1.Cl.Cl |
| InChI | InChI=1S/C13H20N4O2.2ClH/c1-2-11(14)13(18)16-10-3-4-12(15-9-10)17-5-7-19-8-6-17;;/h3-4,9,11H,2,5-8,14H2,1H3,(H,16,18);2*1H/t11-;;/m0../s1 |
| InChIKey | FDIUVHLCCGNPJP-IDMXKUIJSA-N |
| XLogP | 1.44 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |