C16H25N5O3 — CID 43044640
2-(carbamoylamino)-3-methyl-N-(6-morpholin-4-yl-3-pyridinyl)pentanamide (PubChem CID 43044640) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(carbamoylamino)-3-methyl-N-(6-morpholin-4-yl-3-pyridinyl)pentanamide.
| Compound Name | 2-(carbamoylamino)-3-methyl-N-(6-morpholin-4-yl-3-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 43044640 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-(carbamoylamino)-3-methyl-N-(6-morpholin-4-yl-3-pyridinyl)pentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C16H25N5O3/c1-3-11(2)14(20-16(17)23)15(22)19-12-4-5-13(18-10-12)21-6-8-24-9-7-21/h4-5,10-11,14H,3,6-9H2,1-2H3,(H,19,22)(H3,17,20,23) |
| InChIKey | YFXSDDMTIPJASI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |