C17H21N5O3S — CID 55501306
3-(carbamoylamino)-N-(6-morpholin-4-yl-3-pyridinyl)-3-thiophen-2-ylpropanamide (PubChem CID 55501306) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-(6-morpholin-4-yl-3-pyridinyl)-3-thiophen-2-ylpropanamide.
| Compound Name | 3-(carbamoylamino)-N-(6-morpholin-4-yl-3-pyridinyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 55501306 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-(carbamoylamino)-N-(6-morpholin-4-yl-3-pyridinyl)-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)NC(CC(=O)Nc1ccc(N2CCOCC2)nc1)c1cccs1 |
| InChI | InChI=1S/C17H21N5O3S/c18-17(24)21-13(14-2-1-9-26-14)10-16(23)20-12-3-4-15(19-11-12)22-5-7-25-8-6-22/h1-4,9,11,13H,5-8,10H2,(H,20,23)(H3,18,21,24) |
| InChIKey | YWCSFWDHHXBPKS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |