C15H15F2N3O3S — CID 26027113
(3R)-3-(carbamoylamino)-N-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropanamide (PubChem CID 26027113) has the molecular formula C15H15F2N3O3S and a molecular weight of 355.37 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-N-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropanamide.
| Compound Name | (3R)-3-(carbamoylamino)-N-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 26027113 |
| Molecular Formula | C15H15F2N3O3S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (3R)-3-(carbamoylamino)-N-[4-(difluoromethoxy)phenyl]-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)N[C@H](CC(=O)Nc1ccc(OC(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H15F2N3O3S/c16-14(17)23-10-5-3-9(4-6-10)19-13(21)8-11(20-15(18)22)12-2-1-7-24-12/h1-7,11,14H,8H2,(H,19,21)(H3,18,20,22)/t11-/m1/s1 |
| InChIKey | VOLSBGQFFOJVEN-LLVKDONJSA-N |
| XLogP | 3.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |