C13H12F2N2O2S — CID 115286009
2-amino-N-[4-(difluoromethoxy)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 115286009) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-amino-N-[4-(difluoromethoxy)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | 2-amino-N-[4-(difluoromethoxy)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 115286009 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-amino-N-[4-(difluoromethoxy)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | NC(C(=O)Nc1ccc(OC(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C13H12F2N2O2S/c14-13(15)19-9-5-3-8(4-6-9)17-12(18)11(16)10-2-1-7-20-10/h1-7,11,13H,16H2,(H,17,18) |
| InChIKey | VOBMAKKRQCMWJI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |