C15H17F2N2O2S+ — CID 8966062
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8966062) has the molecular formula C15H17F2N2O2S+ and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8966062 |
| Molecular Formula | C15H17F2N2O2S+ |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(OC(F)F)cc1)Cc1cccs1 |
| InChI | InChI=1S/C15H16F2N2O2S/c1-19(9-13-3-2-8-22-13)10-14(20)18-11-4-6-12(7-5-11)21-15(16)17/h2-8,15H,9-10H2,1H3,(H,18,20)/p+1 |
| InChIKey | XSDKMIVKYQXBFT-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |