C17H23N2OS+ — CID 8965607
methyl-[2-oxo-2-(2-propan-2-ylanilino)ethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 8965607) has the molecular formula C17H23N2OS+ and a molecular weight of 303.45 g/mol. Its IUPAC name is methyl-[2-oxo-2-(2-propan-2-ylanilino)ethyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | methyl-[2-oxo-2-(2-propan-2-ylanilino)ethyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8965607 |
| Molecular Formula | C17H23N2OS+ |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl-[2-oxo-2-(2-propan-2-ylanilino)ethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | CC(C)c1ccccc1NC(=O)C[NH+](C)Cc1cccs1 |
| InChI | InChI=1S/C17H22N2OS/c1-13(2)15-8-4-5-9-16(15)18-17(20)12-19(3)11-14-7-6-10-21-14/h4-10,13H,11-12H2,1-3H3,(H,18,20)/p+1 |
| InChIKey | ITEOGLABXIOAIM-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |