C16H21N2OS+ — CID 2541465
methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 2541465) has the molecular formula C16H21N2OS+ and a molecular weight of 289.42 g/mol. Its IUPAC name is methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 2541465 |
| Molecular Formula | C16H21N2OS+ |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | C[C@H](NC(=O)C[NH+](C)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2OS/c1-13(14-7-4-3-5-8-14)17-16(19)12-18(2)11-15-9-6-10-20-15/h3-10,13H,11-12H2,1-2H3,(H,17,19)/p+1/t13-/m0/s1 |
| InChIKey | UIEYLFVYBVUYAO-ZDUSSCGKSA-O |
| XLogP | 1.64 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |