C22H25N2O+ — CID 9261608
methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium (PubChem CID 9261608) has the molecular formula C22H25N2O+ and a molecular weight of 333.46 g/mol. Its IUPAC name is methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium.
| Compound Name | methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 9261608 |
| Molecular Formula | C22H25N2O+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium |
| SMILES | C[C@H](NC(=O)C[NH+](C)Cc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O/c1-17(19-8-4-3-5-9-19)23-22(25)16-24(2)15-18-12-13-20-10-6-7-11-21(20)14-18/h3-14,17H,15-16H2,1-2H3,(H,23,25)/p+1/t17-/m0/s1 |
| InChIKey | PEKLXDGXGKPRLA-KRWDZBQOSA-O |
| XLogP | 2.73 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |