C21H20F3N2O+ — CID 9261664
methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 9261664) has the molecular formula C21H20F3N2O+ and a molecular weight of 373.40 g/mol. Its IUPAC name is methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 9261664 |
| Molecular Formula | C21H20F3N2O+ |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1C(F)(F)F)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19F3N2O/c1-26(13-15-10-11-16-6-2-3-7-17(16)12-15)14-20(27)25-19-9-5-4-8-18(19)21(22,23)24/h2-12H,13-14H2,1H3,(H,25,27)/p+1 |
| InChIKey | KLPQZFHENJSBQV-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |