C21H26F3N2O2+ — CID 7480380
(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 7480380) has the molecular formula C21H26F3N2O2+ and a molecular weight of 395.45 g/mol. Its IUPAC name is (2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | (2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 7480380 |
| Molecular Formula | C21H26F3N2O2+ |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | Cc1cc(O)c(C[NH+](C)CC(=O)Nc2ccccc2C(F)(F)F)cc1C(C)C |
| InChI | InChI=1S/C21H25F3N2O2/c1-13(2)16-10-15(19(27)9-14(16)3)11-26(4)12-20(28)25-18-8-6-5-7-17(18)21(22,23)24/h5-10,13,27H,11-12H2,1-4H3,(H,25,28)/p+1 |
| InChIKey | LTSBHSGVAXPLTO-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|