C19H21F3N3O3+ — CID 7480397
[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 7480397) has the molecular formula C19H21F3N3O3+ and a molecular weight of 396.39 g/mol. Its IUPAC name is [(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | [(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 7480397 |
| Molecular Formula | C19H21F3N3O3+ |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1C(F)(F)F)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C19H20F3N3O3/c1-24(11-25-17(27)12-6-2-3-7-13(12)18(25)28)10-16(26)23-15-9-5-4-8-14(15)19(20,21)22/h2-5,8-9,12-13H,6-7,10-11H2,1H3,(H,23,26)/p+1/t12-,13+ |
| InChIKey | YPYJXUMGTWJOSV-BETUJISGSA-O |
| XLogP | 1.07 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|