C19H23ClN3O4+ — CID 11921034
[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 11921034) has the molecular formula C19H23ClN3O4+ and a molecular weight of 392.86 g/mol. Its IUPAC name is [(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 11921034 |
| Molecular Formula | C19H23ClN3O4+ |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(Cl)cc1NC(=O)C[NH+](C)CN1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C19H22ClN3O4/c1-22(10-17(24)21-15-9-12(20)7-8-16(15)27-2)11-23-18(25)13-5-3-4-6-14(13)19(23)26/h3-4,7-9,13-14H,5-6,10-11H2,1-2H3,(H,21,24)/p+1/t13-,14-/m0/s1 |
| InChIKey | UGXKYRROVOQMAR-KBPBESRZSA-O |
| XLogP | 0.71 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|