C18H19ClN2O4 — CID 7900754
3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(5-chloro-2-methoxyphenyl)propanamide (PubChem CID 7900754) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(5-chloro-2-methoxyphenyl)propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(5-chloro-2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 7900754 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(5-chloro-2-methoxyphenyl)propanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CCN1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C18H19ClN2O4/c1-25-15-7-6-11(19)10-14(15)20-16(22)8-9-21-17(23)12-4-2-3-5-13(12)18(21)24/h2-3,6-7,10,12-13H,4-5,8-9H2,1H3,(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | MUZJPBMEUHBVQR-STQMWFEESA-N |
| XLogP | 2.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|