C23H22F3N2O+ — CID 2461411
benzhydryl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 2461411) has the molecular formula C23H22F3N2O+ and a molecular weight of 399.44 g/mol. Its IUPAC name is benzhydryl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | benzhydryl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 2461411 |
| Molecular Formula | C23H22F3N2O+ |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | benzhydryl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21F3N2O/c1-28(16-21(29)27-20-15-9-8-14-19(20)23(24,25)26)22(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15,22H,16H2,1H3,(H,27,29)/p+1 |
| InChIKey | ZOYNWCBYKUMFFK-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |