C23H21F3N2O — CID 9393079
2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9393079) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9393079 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc([C@H](NCC(=O)Nc2ccccc2C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21F3N2O/c1-16-11-13-18(14-12-16)22(17-7-3-2-4-8-17)27-15-21(29)28-20-10-6-5-9-19(20)23(24,25)26/h2-14,22,27H,15H2,1H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | SBDXADLYNWXTJX-JOCHJYFZSA-N |
| XLogP | 5.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |