C23H23ClN2O — CID 9392747
N-(2-chloro-4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide (PubChem CID 9392747) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 9392747 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide |
| SMILES | Cc1ccc([C@@H](NCC(=O)Nc2ccc(C)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23ClN2O/c1-16-8-11-19(12-9-16)23(18-6-4-3-5-7-18)25-15-22(27)26-21-13-10-17(2)14-20(21)24/h3-14,23,25H,15H2,1-2H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | DXULCKLEJSZKAI-QHCPKHFHSA-N |
| XLogP | 5.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |