C23H24N2O — CID 9392626
N-(4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide (PubChem CID 9392626) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 9392626 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-(4-methylphenyl)-2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetamide |
| SMILES | Cc1ccc(NC(=O)CN[C@@H](c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-17-8-12-20(13-9-17)23(19-6-4-3-5-7-19)24-16-22(26)25-21-14-10-18(2)11-15-21/h3-15,23-24H,16H2,1-2H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | OGHDDEVJRROYJN-QHCPKHFHSA-N |
| XLogP | 4.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |