C16H16N2O4 — CID 51531541
2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyphenyl)acetamide (PubChem CID 51531541) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 51531541 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)Nc1ccccc1O |
| InChI | InChI=1S/C16H16N2O4/c19-13-8-4-3-7-12(13)17-14(20)9-18-15(21)10-5-1-2-6-11(10)16(18)22/h1-4,7-8,10-11,19H,5-6,9H2,(H,17,20)/t10-,11-/m1/s1 |
| InChIKey | GQPZQKLPMIYYSU-GHMZBOCLSA-N |
| XLogP | 1.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|