C25H25N3O4 — CID 124823995
2-[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 124823995) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 124823995 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)CN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O4/c1-16(17-9-3-2-4-10-17)26-23(30)20-13-7-8-14-21(20)27-22(29)15-28-24(31)18-11-5-6-12-19(18)25(28)32/h2-10,13-14,16,18-19H,11-12,15H2,1H3,(H,26,30)(H,27,29)/t16-,18+,19+/m0/s1 |
| InChIKey | FHOIQBUMBWRYPL-QXAKKESOSA-N |
| XLogP | 3.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|