C26H27N3O4 — CID 51525831
2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoylamino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 51525831) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoylamino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoylamino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 51525831 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoylamino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)CCN1C(=O)[C@H]2CC=CC[C@@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c1-17(18-9-3-2-4-10-18)27-24(31)21-13-7-8-14-22(21)28-23(30)15-16-29-25(32)19-11-5-6-12-20(19)26(29)33/h2-10,13-14,17,19-20H,11-12,15-16H2,1H3,(H,27,31)(H,28,30)/t17-,19-,20-/m0/s1 |
| InChIKey | USZKNERQFHMCFU-IHPCNDPISA-N |
| XLogP | 3.46 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|