C20H24N2O3 — CID 132761001
3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1-phenylpropyl)propanamide (PubChem CID 132761001) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1-phenylpropyl)propanamide.
| Compound Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 132761001 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1-phenylpropyl)propanamide |
| SMILES | CCC(NC(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-17(14-8-4-3-5-9-14)21-18(23)12-13-22-19(24)15-10-6-7-11-16(15)20(22)25/h3-9,15-17H,2,10-13H2,1H3,(H,21,23)/t15-,16+,17? |
| InChIKey | QZIKXVFTNGXNFJ-SJPCQFCGSA-N |
| XLogP | 2.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|