C21H26N2O4 — CID 132655559
3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[1-(2-methylphenoxy)propan-2-yl]propanamide (PubChem CID 132655559) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[1-(2-methylphenoxy)propan-2-yl]propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[1-(2-methylphenoxy)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 132655559 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[1-(2-methylphenoxy)propan-2-yl]propanamide |
| SMILES | Cc1ccccc1OCC(C)NC(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C21H26N2O4/c1-14-7-3-6-10-18(14)27-13-15(2)22-19(24)11-12-23-20(25)16-8-4-5-9-17(16)21(23)26/h3-7,10,15-17H,8-9,11-13H2,1-2H3,(H,22,24)/t15?,16-,17+ |
| InChIKey | RFJOODUTGQPHGD-ALOPSCKCSA-N |
| XLogP | 2.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|