C19H21N3O4 — CID 8817453
2-[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoylamino]benzamide (PubChem CID 8817453) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoylamino]benzamide.
| Compound Name | 2-[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoylamino]benzamide |
|---|---|
| PubChem CID | 8817453 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoylamino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CCCN1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C19H21N3O4/c20-17(24)14-8-3-4-9-15(14)21-16(23)10-5-11-22-18(25)12-6-1-2-7-13(12)19(22)26/h1-4,8-9,12-13H,5-7,10-11H2,(H2,20,24)(H,21,23)/t12-,13-/m0/s1 |
| InChIKey | BEVRHVZLMYUEFX-STQMWFEESA-N |
| XLogP | 1.46 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|