C15H17N3O4 — CID 2219826
2-[4-(2,5-dioxopyrrolidin-1-yl)butanoylamino]benzamide (PubChem CID 2219826) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[4-(2,5-dioxopyrrolidin-1-yl)butanoylamino]benzamide.
| Compound Name | 2-[4-(2,5-dioxopyrrolidin-1-yl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 2219826 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[4-(2,5-dioxopyrrolidin-1-yl)butanoylamino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C15H17N3O4/c16-15(22)10-4-1-2-5-11(10)17-12(19)6-3-9-18-13(20)7-8-14(18)21/h1-2,4-5H,3,6-9H2,(H2,16,22)(H,17,19) |
| InChIKey | PVILEHDJGVJUIV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|