C14H15IN2O3 — CID 17034974
4-(2,5-dioxopyrrolidin-1-yl)-N-(2-iodophenyl)butanamide (PubChem CID 17034974) has the molecular formula C14H15IN2O3 and a molecular weight of 386.19 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-iodophenyl)butanamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-iodophenyl)butanamide |
|---|---|
| PubChem CID | 17034974 |
| Molecular Formula | C14H15IN2O3 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-iodophenyl)butanamide |
| SMILES | O=C(CCCN1C(=O)CCC1=O)Nc1ccccc1I |
| InChI | InChI=1S/C14H15IN2O3/c15-10-4-1-2-5-11(10)16-12(18)6-3-9-17-13(19)7-8-14(17)20/h1-2,4-5H,3,6-9H2,(H,16,18) |
| InChIKey | YGBOZRQJTUKYIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|