C16H19ClN2O3 — CID 17035040
N-(2-chlorophenyl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide (PubChem CID 17035040) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide.
| Compound Name | N-(2-chlorophenyl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 17035040 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(2-chlorophenyl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)CCC1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN2O3/c17-12-6-3-4-7-13(12)18-14(20)8-2-1-5-11-19-15(21)9-10-16(19)22/h3-4,6-7H,1-2,5,8-11H2,(H,18,20) |
| InChIKey | RCEQXEDFOWUYHP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|