C12H11ClN2O3 — CID 17034752
N-(2-chlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 17034752) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 17034752 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)CCC1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O3/c13-8-3-1-2-4-9(8)14-10(16)7-15-11(17)5-6-12(15)18/h1-4H,5-7H2,(H,14,16) |
| InChIKey | SIBBEQJSQKQTHZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|