C16H13ClN2O3 — CID 2993365
N-(2-chlorophenyl)-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 2993365) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 2993365 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccccc21)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H13ClN2O3/c17-11-5-1-2-6-12(11)18-15(20)9-19-13-7-3-4-8-14(13)22-10-16(19)21/h1-8H,9-10H2,(H,18,20) |
| InChIKey | XTYBIRQUSYHDQO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |