C16H12BrClN2O3 — CID 3494008
N-(2-bromophenyl)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 3494008) has the molecular formula C16H12BrClN2O3 and a molecular weight of 395.64 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 3494008 |
| Molecular Formula | C16H12BrClN2O3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | N-(2-bromophenyl)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc(Cl)cc21)Nc1ccccc1Br |
| InChI | InChI=1S/C16H12BrClN2O3/c17-11-3-1-2-4-12(11)19-15(21)8-20-13-7-10(18)5-6-14(13)23-9-16(20)22/h1-7H,8-9H2,(H,19,21) |
| InChIKey | RSGFIZUJZGDLDA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |