C21H22ClN3O3 — CID 25336533
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide (PubChem CID 25336533) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 25336533 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc(Cl)cc21)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C21H22ClN3O3/c22-15-8-9-19-18(12-15)25(21(27)14-28-19)13-20(26)23-16-6-2-3-7-17(16)24-10-4-1-5-11-24/h2-3,6-9,12H,1,4-5,10-11,13-14H2,(H,23,26) |
| InChIKey | JTGPREYPAOBXFI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |