C21H23Br2ClN2O3 — CID 98105991
N-(2-chlorophenyl)-6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide (PubChem CID 98105991) has the molecular formula C21H23Br2ClN2O3 and a molecular weight of 546.69 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide.
| Compound Name | N-(2-chlorophenyl)-6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide |
|---|---|
| PubChem CID | 98105991 |
| Molecular Formula | C21H23Br2ClN2O3 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | N-(2-chlorophenyl)-6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)[C@H]2[C@@H]3C[C@@H]([C@@H](Br)[C@H]3Br)[C@@H]2C1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H23Br2ClN2O3/c22-18-11-10-12(19(18)23)17-16(11)20(28)26(21(17)29)9-5-1-2-8-15(27)25-14-7-4-3-6-13(14)24/h3-4,6-7,11-12,16-19H,1-2,5,8-10H2,(H,25,27)/t11-,12+,16-,17-,18-,19+/m0/s1 |
| InChIKey | GTWPKQTUKNICGD-VFBCTUTHSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|