C21H23Br2ClN2O3 — CID 3289929
N-(4-chlorophenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide (PubChem CID 3289929) has the molecular formula C21H23Br2ClN2O3 and a molecular weight of 546.69 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide.
| Compound Name | N-(4-chlorophenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide |
|---|---|
| PubChem CID | 3289929 |
| Molecular Formula | C21H23Br2ClN2O3 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | N-(4-chlorophenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C2C3CC(C(Br)C3Br)C2C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23Br2ClN2O3/c22-18-13-10-14(19(18)23)17-16(13)20(28)26(21(17)29)9-3-1-2-4-15(27)25-12-7-5-11(24)6-8-12/h5-8,13-14,16-19H,1-4,9-10H2,(H,25,27) |
| InChIKey | OZWGRPGCTZWAKE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|