C21H23Br2ClN2O4 — CID 124722848
N-(5-chloro-2-hydroxyphenyl)-6-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide (PubChem CID 124722848) has the molecular formula C21H23Br2ClN2O4 and a molecular weight of 562.69 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-6-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-6-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide |
|---|---|
| PubChem CID | 124722848 |
| Molecular Formula | C21H23Br2ClN2O4 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-6-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C1=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C21H23Br2ClN2O4/c22-18-11-9-12(19(18)23)17-16(11)20(29)26(21(17)30)7-3-1-2-4-15(28)25-13-8-10(24)5-6-14(13)27/h5-6,8,11-12,16-19,27H,1-4,7,9H2,(H,25,28)/t11-,12-,16-,17-,18+,19+/m1/s1 |
| InChIKey | SSXJELBZSSLGOF-VNUXUXBQSA-N |
| XLogP | 4.32 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|